![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Wiper and Washer Systems/ | 2019-07-03 16:22 | - | |
| SUNROOFT-TOPCONVERTIBLE TOP (SUNROOF)/ | 2019-07-03 16:22 | - | |
| Security and Locks/ | 2019-07-03 16:22 | - | |
| Seats/ | 2019-07-03 16:22 | - | |
| Seat Belt System/ | 2019-07-03 16:22 | - | |
| Lighting System/ | 2019-07-03 16:22 | - | |
| Instrumentation Driver Info/ | 2019-07-03 16:22 | - | |
| HVAC SYSTEM (HEATER VENTILATOR AND AC)/ | 2019-07-03 16:22 | - | |
| HVAC SYSTEM (AUTO AC) (DIAGNOSTICS)/ | 2019-07-03 16:22 | - | |
| Glass Windows Mirrors/ | 2019-07-03 16:22 | - | |
| EXTERIORINTERIOR TRIM/ | 2019-07-03 16:22 | - | |
| EXTERIOR BODY PANELS/ | 2019-07-03 16:22 | - | |
| Entertainment/ | 2019-07-03 16:22 | - | |
| CRUISE CONTROL SYSTEM (DIAGNOSTICS)/ | 2019-07-03 16:22 | - | |
| CRUISE CONTROL SYSTEM/ | 2019-07-03 16:22 | - | |
| Communication System/ | 2019-07-03 16:22 | - | |
| Body Structure/ | 2019-07-03 16:22 | - | |
| Airbag System (Diagnostics)/ | 2019-07-03 16:22 | - | |
| Airbag System/ | 2019-07-03 16:22 | - | |